Maths Olympiad Prep

Track / Stage 7 / 111 of 300 #1511 of 1964

Problem 1511

National Olympiad second round; IMO P1/P4
Number theory Difficulty 7.2 Prove it

Suppose that mm and kk are non-negative integers, and p=22m+1p = 2^{2^m}+1 is a prime number. Prove that
(a) 22m+1pk12^{2^{m+1}p^k} \equiv 1 (mod pk+1)(\text{mod } p^{k+1});
(b) 2m+1pk2^{m+1}p^k is the smallest positive integer nn satisfying the congruence equation 2n12^n \equiv 1 (mod pk+1)(\text{mod } p^{k+1}).

This one wants a proof. Work it on paper, then read the official solution and mark yourself. Be honest about it: the record is only any use to you if it is.

Next problem →

Official solution

(a) Prove that 22m+1pk1(modpk+1)2^{2^{m+1}p^k} \equiv 1 \pmod{p^{k+1}}.

1. Define a=22ma = 2^{2^m} and b=1b = -1. Note that ab=22m(1)=22m+1=pa - b = 2^{2^m} - (-1) = 2^{2^m} + 1 = p, so pabp \mid a - b.
2. Using the Euclidean Algorithm, we find:
gcd(p,ab)=gcd(22m+1,22m)=gcd(1,22m)=1. \gcd(p, ab) = \gcd(2^{2^m} + 1, -2^{2^m}) = \gcd(1, -2^{2^m}) = 1.
Thus, pabp \mid a - b and gcd(p,ab)=1\gcd(p, ab) = 1.
3. Apply the Lifting The Exponent (LTE) Lemma with the prime pp as the base:
νp(apkbpk)=νp(pk)+νp(ab). \nu_p(a^{p^k} - b^{p^k}) = \nu_p(p^k) + \nu_p(a - b).
4. Since pp is odd, pkp^k is also odd, so (1)pk=1(-1)^{p^k} = -1. Therefore:
νp((22m)pk(1)pk)=νp(pk)+νp(p). \nu_p((2^{2^m})^{p^k} - (-1)^{p^k}) = \nu_p(p^k) + \nu_p(p).
5. Simplifying, we get:
νp(22mpk+1)=k+1. \nu_p(2^{2^m p^k} + 1) = k + 1.
6. Taking modulo pk+1p^{k+1}, we have:
22mpk+10(modpk+1), 2^{2^m p^k} + 1 \equiv 0 \pmod{p^{k+1}},
which implies:
22mpk1(modpk+1). 2^{2^m p^k} \equiv -1 \pmod{p^{k+1}}.
7. Squaring both sides, we get:
222mpk1(modpk+1), 2^{2 \cdot 2^m p^k} \equiv 1 \pmod{p^{k+1}},
or equivalently:
22m+1pk1(modpk+1). 2^{2^{m+1} p^k} \equiv 1 \pmod{p^{k+1}}.

(b) Prove that 2m+1pk2^{m+1} p^k is the smallest positive integer nn satisfying 2n1(modpk+1)2^n \equiv 1 \pmod{p^{k+1}}.

1. From part (a), we have shown that 22m+1pk1(modpk+1)2^{2^{m+1} p^k} \equiv 1 \pmod{p^{k+1}}. This implies that the order of 2 modulo pk+1p^{k+1} divides 2m+1pk2^{m+1} p^k.
2. Since 22mpk1≢1(modpk+1)2^{2^m p^k} \equiv -1 \not\equiv 1 \pmod{p^{k+1}}, it follows that ν2(ordpk+1(2))=m+1\nu_2(\text{ord}_{p^{k+1}}(2)) = m+1.
3. Therefore, the order of 2 modulo pk+1p^{k+1} must be of the form 2m+1pi2^{m+1} p^i for some i{0,1,,k}i \in \{0, 1, \ldots, k\}.
4. Apply the LTE Lemma again with c=22m+1c = 2^{2^{m+1}} and d=1d = 1:
cd=22m+11=(22m+1)(22m1)=p(p2). c - d = 2^{2^{m+1}} - 1 = (2^{2^m} + 1)(2^{2^m} - 1) = p(p-2).
5. Thus, c=p(p2)+d=p(p2)+1=p22p+1=(p1)2c = p(p-2) + d = p(p-2) + 1 = p^2 - 2p + 1 = (p-1)^2.
6. Since gcd(p,cd)=gcd(p,(p1)2)=1\gcd(p, cd) = \gcd(p, (p-1)^2) = 1, we can apply the LTE Lemma:
νp(cpidpi)=νp(pi)+νp(cd). \nu_p(c^{p^i} - d^{p^i}) = \nu_p(p^i) + \nu_p(c - d).
7. Substituting cd=p(p2)c - d = p(p-2), we get:
νp(22m+1pi1)=i+1. \nu_p(2^{2^{m+1} p^i} - 1) = i + 1.
8. Since ordpk+1(2)=2m+1pi\text{ord}_{p^{k+1}}(2) = 2^{m+1} p^i, it follows that:
22m+1pi1(modpk+1), 2^{2^{m+1} p^i} \equiv 1 \pmod{p^{k+1}},
implying:
νp(22m+1pi)k+1. \nu_p(2^{2^{m+1} p^i}) \ge k + 1.
9. Since νp(22m+1pi1)=i+1\nu_p(2^{2^{m+1} p^i} - 1) = i + 1, it follows that i+1k+1i + 1 \ge k + 1, or i=ki = k since i{0,1,,k}i \in \{0, 1, \ldots, k\}.
10. Hence, we conclude that:
ordpk+1(2)=2m+1pk. \text{ord}_{p^{k+1}}(2) = 2^{m+1} p^k.

Source: NuminaMath-1.5, licensed Apache-2.0. Statement reproduced verbatim; metadata (topic, difficulty, ordering) added by this project.